C15H9Cl2F4NO2S — CID 19426439
2-(cyclopropanecarbonyl)-3-[3,4-dichloro-2-(1,1,2,2-tetrafluoroethylsulfanyl)phenyl]-3-oxopropanenitrile (PubChem CID 19426439) has the molecular formula C15H9Cl2F4NO2S and a molecular weight of 414.21 g/mol. Its IUPAC name is 2-(cyclopropanecarbonyl)-3-[3,4-dichloro-2-(1,1,2,2-tetrafluoroethylsulfanyl)phenyl]-3-oxopropanenitrile.
| Compound Name | 2-(cyclopropanecarbonyl)-3-[3,4-dichloro-2-(1,1,2,2-tetrafluoroethylsulfanyl)phenyl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 19426439 |
| Molecular Formula | C15H9Cl2F4NO2S |
| Molecular Weight | 414.21 g/mol |
| Exact Mass | 412.97 |
| IUPAC Name | 2-(cyclopropanecarbonyl)-3-[3,4-dichloro-2-(1,1,2,2-tetrafluoroethylsulfanyl)phenyl]-3-oxopropanenitrile |
| SMILES | N#CC(C(=O)c1ccc(Cl)c(Cl)c1SC(F)(F)C(F)F)C(=O)C1CC1 |
| InChI | InChI=1S/C15H9Cl2F4NO2S/c16-9-4-3-7(12(24)8(5-22)11(23)6-1-2-6)13(10(9)17)25-15(20,21)14(18)19/h3-4,6,8,14H,1-2H2 |
| InChIKey | VBRIFAPHFCAYOY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.21 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|