About 5-(2,3-dihydroxyphenoxy)benzene-1,2,3-triol
5-(2,3-dihydroxyphenoxy)benzene-1,2,3-triol (PubChem CID 19426542) has the molecular formula C12H10O6
and a molecular weight of 250.21 g/mol. Its IUPAC name is 5-(2,3-dihydroxyphenoxy)benzene-1,2,3-triol.
Molecular Properties
| Compound Name | 5-(2,3-dihydroxyphenoxy)benzene-1,2,3-triol |
| PubChem CID | 19426542 |
| Molecular Formula | C12H10O6 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 5-(2,3-dihydroxyphenoxy)benzene-1,2,3-triol |
| SMILES | Oc1cc(Oc2cccc(O)c2O)cc(O)c1O |
| InChI | InChI=1S/C12H10O6/c13-7-2-1-3-10(12(7)17)18-6-4-8(14)11(16)9(15)5-6/h1-5,13-17H |
| InChIKey | VRUMSEIALUJVJO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,3-dihydroxyphenoxy)benzene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dihydroxyphenoxy)benzene-1,2,3-triol?
The IUPAC name of 5-(2,3-dihydroxyphenoxy)benzene-1,2,3-triol (CID 19426542) is 5-(2,3-dihydroxyphenoxy)benzene-1,2,3-triol.
What is the SMILES notation for 5-(2,3-dihydroxyphenoxy)benzene-1,2,3-triol?
The canonical SMILES for 5-(2,3-dihydroxyphenoxy)benzene-1,2,3-triol is Oc1cc(Oc2cccc(O)c2O)cc(O)c1O.
What is the InChIKey of 5-(2,3-dihydroxyphenoxy)benzene-1,2,3-triol?
The InChIKey is VRUMSEIALUJVJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O6/c13-7-2-1-3-10(12(7)17)18-6-4-8(14)11(16)9(15)5-6/h1-5,13-17H.
What are the key properties of 5-(2,3-dihydroxyphenoxy)benzene-1,2,3-triol?
5-(2,3-dihydroxyphenoxy)benzene-1,2,3-triol has a molecular weight of 250.21 g/mol, XLogP of 2.01, 2 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dihydroxyphenoxy)benzene-1,2,3-triol is sourced from PubChem (CID 19426542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).