C12H14FN3O3 — CID 19426799
1-[[3-(4-fluorophenyl)-5-methyl-4,5-dihydro-1,2-oxazol-4-yl]methyl]-1-hydroxyurea (PubChem CID 19426799) has the molecular formula C12H14FN3O3 and a molecular weight of 267.26 g/mol. Its IUPAC name is 1-[[3-(4-fluorophenyl)-5-methyl-4,5-dihydro-1,2-oxazol-4-yl]methyl]-1-hydroxyurea.
| Compound Name | 1-[[3-(4-fluorophenyl)-5-methyl-4,5-dihydro-1,2-oxazol-4-yl]methyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 19426799 |
| Molecular Formula | C12H14FN3O3 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-[[3-(4-fluorophenyl)-5-methyl-4,5-dihydro-1,2-oxazol-4-yl]methyl]-1-hydroxyurea |
| SMILES | CC1ON=C(c2ccc(F)cc2)C1CN(O)C(N)=O |
| InChI | InChI=1S/C12H14FN3O3/c1-7-10(6-16(18)12(14)17)11(15-19-7)8-2-4-9(13)5-3-8/h2-5,7,10,18H,6H2,1H3,(H2,14,17) |
| InChIKey | MTCNNNRQPYWNLT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|