C8H4BrF6NO — CID 19426938
2-(6-bromo-2-pyridinyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 19426938) has the molecular formula C8H4BrF6NO and a molecular weight of 324.02 g/mol. Its IUPAC name is 2-(6-bromo-2-pyridinyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(6-bromo-2-pyridinyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 19426938 |
| Molecular Formula | C8H4BrF6NO |
| Molecular Weight | 324.02 g/mol |
| Exact Mass | 322.94 |
| IUPAC Name | 2-(6-bromo-2-pyridinyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1cccc(Br)n1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H4BrF6NO/c9-5-3-1-2-4(16-5)6(17,7(10,11)12)8(13,14)15/h1-3,17H |
| InChIKey | FVAAOCYFPRQZNQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.02 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|