About (3,5-difluorophenyl)-(1,3-thiazol-2-yl)methanone
(3,5-difluorophenyl)-(1,3-thiazol-2-yl)methanone (PubChem CID 19426944) has the molecular formula C10H5F2NOS
and a molecular weight of 225.22 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(1,3-thiazol-2-yl)methanone.
Molecular Properties
| Compound Name | (3,5-difluorophenyl)-(1,3-thiazol-2-yl)methanone |
| PubChem CID | 19426944 |
| Molecular Formula | C10H5F2NOS |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | (3,5-difluorophenyl)-(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1cc(F)cc(F)c1)c1nccs1 |
| InChI | InChI=1S/C10H5F2NOS/c11-7-3-6(4-8(12)5-7)9(14)10-13-1-2-15-10/h1-5H |
| InChIKey | QQKPHUJQJGXVPD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,5-difluorophenyl)-(1,3-thiazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-difluorophenyl)-(1,3-thiazol-2-yl)methanone?
The IUPAC name of (3,5-difluorophenyl)-(1,3-thiazol-2-yl)methanone (CID 19426944) is (3,5-difluorophenyl)-(1,3-thiazol-2-yl)methanone.
What is the SMILES notation for (3,5-difluorophenyl)-(1,3-thiazol-2-yl)methanone?
The canonical SMILES for (3,5-difluorophenyl)-(1,3-thiazol-2-yl)methanone is O=C(c1cc(F)cc(F)c1)c1nccs1.
What is the InChIKey of (3,5-difluorophenyl)-(1,3-thiazol-2-yl)methanone?
The InChIKey is QQKPHUJQJGXVPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F2NOS/c11-7-3-6(4-8(12)5-7)9(14)10-13-1-2-15-10/h1-5H.
What are the key properties of (3,5-difluorophenyl)-(1,3-thiazol-2-yl)methanone?
(3,5-difluorophenyl)-(1,3-thiazol-2-yl)methanone has a molecular weight of 225.22 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-difluorophenyl)-(1,3-thiazol-2-yl)methanone is sourced from PubChem (CID 19426944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).