C11H5F11OS — CID 19427024
1,1,1,2,2,4,4,5,5,5-decafluoro-3-(3-fluoro-5-sulfanylphenyl)pentan-3-ol (PubChem CID 19427024) has the molecular formula C11H5F11OS and a molecular weight of 394.21 g/mol. Its IUPAC name is 1,1,1,2,2,4,4,5,5,5-decafluoro-3-(3-fluoro-5-sulfanylphenyl)pentan-3-ol.
| Compound Name | 1,1,1,2,2,4,4,5,5,5-decafluoro-3-(3-fluoro-5-sulfanylphenyl)pentan-3-ol |
|---|---|
| PubChem CID | 19427024 |
| Molecular Formula | C11H5F11OS |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 1,1,1,2,2,4,4,5,5,5-decafluoro-3-(3-fluoro-5-sulfanylphenyl)pentan-3-ol |
| SMILES | OC(c1cc(F)cc(S)c1)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5F11OS/c12-5-1-4(2-6(24)3-5)7(23,8(13,14)10(17,18)19)9(15,16)11(20,21)22/h1-3,23-24H |
| InChIKey | IPMVNLXJYTZCTG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|