About 5-bromo-1-oxo-3,4-dihydro-2H-thiochromen-3-amine
5-bromo-1-oxo-3,4-dihydro-2H-thiochromen-3-amine (PubChem CID 19427098) has the molecular formula C9H10BrNOS
and a molecular weight of 260.16 g/mol. Its IUPAC name is 5-bromo-1-oxo-3,4-dihydro-2H-thiochromen-3-amine.
Molecular Properties
| Compound Name | 5-bromo-1-oxo-3,4-dihydro-2H-thiochromen-3-amine |
| PubChem CID | 19427098 |
| Molecular Formula | C9H10BrNOS |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 258.97 |
| IUPAC Name | 5-bromo-1-oxo-3,4-dihydro-2H-thiochromen-3-amine |
| SMILES | NC1Cc2c(Br)cccc2S(=O)C1 |
| InChI | InChI=1S/C9H10BrNOS/c10-8-2-1-3-9-7(8)4-6(11)5-13(9)12/h1-3,6H,4-5,11H2 |
| InChIKey | RFLRFJGITKWTKQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-1-oxo-3,4-dihydro-2H-thiochromen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-oxo-3,4-dihydro-2H-thiochromen-3-amine?
The IUPAC name of 5-bromo-1-oxo-3,4-dihydro-2H-thiochromen-3-amine (CID 19427098) is 5-bromo-1-oxo-3,4-dihydro-2H-thiochromen-3-amine.
What is the SMILES notation for 5-bromo-1-oxo-3,4-dihydro-2H-thiochromen-3-amine?
The canonical SMILES for 5-bromo-1-oxo-3,4-dihydro-2H-thiochromen-3-amine is NC1Cc2c(Br)cccc2S(=O)C1.
What is the InChIKey of 5-bromo-1-oxo-3,4-dihydro-2H-thiochromen-3-amine?
The InChIKey is RFLRFJGITKWTKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNOS/c10-8-2-1-3-9-7(8)4-6(11)5-13(9)12/h1-3,6H,4-5,11H2.
What are the key properties of 5-bromo-1-oxo-3,4-dihydro-2H-thiochromen-3-amine?
5-bromo-1-oxo-3,4-dihydro-2H-thiochromen-3-amine has a molecular weight of 260.16 g/mol, XLogP of 1.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-oxo-3,4-dihydro-2H-thiochromen-3-amine is sourced from PubChem (CID 19427098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).