About 4-(3,4-dihydroxyphenoxy)benzene-1,3-diol
4-(3,4-dihydroxyphenoxy)benzene-1,3-diol (PubChem CID 19427119) has the molecular formula C12H10O5
and a molecular weight of 234.21 g/mol. Its IUPAC name is 4-(3,4-dihydroxyphenoxy)benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-(3,4-dihydroxyphenoxy)benzene-1,3-diol |
| PubChem CID | 19427119 |
| Molecular Formula | C12H10O5 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 4-(3,4-dihydroxyphenoxy)benzene-1,3-diol |
| SMILES | Oc1ccc(Oc2ccc(O)c(O)c2)c(O)c1 |
| InChI | InChI=1S/C12H10O5/c13-7-1-4-12(11(16)5-7)17-8-2-3-9(14)10(15)6-8/h1-6,13-16H |
| InChIKey | RDRVKOASYNGFKW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-dihydroxyphenoxy)benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dihydroxyphenoxy)benzene-1,3-diol?
The IUPAC name of 4-(3,4-dihydroxyphenoxy)benzene-1,3-diol (CID 19427119) is 4-(3,4-dihydroxyphenoxy)benzene-1,3-diol.
What is the SMILES notation for 4-(3,4-dihydroxyphenoxy)benzene-1,3-diol?
The canonical SMILES for 4-(3,4-dihydroxyphenoxy)benzene-1,3-diol is Oc1ccc(Oc2ccc(O)c(O)c2)c(O)c1.
What is the InChIKey of 4-(3,4-dihydroxyphenoxy)benzene-1,3-diol?
The InChIKey is RDRVKOASYNGFKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O5/c13-7-1-4-12(11(16)5-7)17-8-2-3-9(14)10(15)6-8/h1-6,13-16H.
What are the key properties of 4-(3,4-dihydroxyphenoxy)benzene-1,3-diol?
4-(3,4-dihydroxyphenoxy)benzene-1,3-diol has a molecular weight of 234.21 g/mol, XLogP of 2.30, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydroxyphenoxy)benzene-1,3-diol is sourced from PubChem (CID 19427119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).