(2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate

C9H11NO4 — CID 19428439

IUPAC(2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate
SMILESC=C(C)C(=O)OCN1C(=O)CCC1=O
InChIInChI=1S/C9H11NO4/c1-6(2)9(13)14-5-10-7(11)3-4-8(10)12/h1,3-5H2,2H3
InChIKeyNICJSGKSWSSPJS-UHFFFAOYSA-N
MW197.19 g/mol
LogP0.21
Rot. Bonds3

About (2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate

(2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate (PubChem CID 19428439) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate.

Molecular Properties

Compound Name(2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate
PubChem CID19428439
Molecular FormulaC9H11NO4
Molecular Weight197.19 g/mol
Exact Mass197.07
IUPAC Name(2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate
SMILESC=C(C)C(=O)OCN1C(=O)CCC1=O
InChIInChI=1S/C9H11NO4/c1-6(2)9(13)14-5-10-7(11)3-4-8(10)12/h1,3-5H2,2H3
InChIKeyNICJSGKSWSSPJS-UHFFFAOYSA-N
XLogP0.21
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.19
LogP ≤ 50.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze (2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate (CID 19428439) is (2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate is C=C(C)C(=O)OCN1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate?
The InChIKey is NICJSGKSWSSPJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4/c1-6(2)9(13)14-5-10-7(11)3-4-8(10)12/h1,3-5H2,2H3.
What are the key properties of (2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate?
(2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate has a molecular weight of 197.19 g/mol, XLogP of 0.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl)methyl 2-methylprop-2-enoate is sourced from PubChem (CID 19428439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).