About 3-fluoropentane
3-fluoropentane (PubChem CID 19428854) has the molecular formula C5H11F
and a molecular weight of 90.14 g/mol. Its IUPAC name is 3-fluoropentane.
Molecular Properties
| Compound Name | 3-fluoropentane |
| PubChem CID | 19428854 |
| Molecular Formula | C5H11F |
| Molecular Weight | 90.14 g/mol |
| Exact Mass | 90.08 |
| IUPAC Name | 3-fluoropentane |
| SMILES | CCC(F)CC |
| InChI | InChI=1S/C5H11F/c1-3-5(6)4-2/h5H,3-4H2,1-2H3 |
| InChIKey | FBWYFZYJEAMPHJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.14 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-fluoropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoropentane?
The IUPAC name of 3-fluoropentane (CID 19428854) is 3-fluoropentane.
What is the SMILES notation for 3-fluoropentane?
The canonical SMILES for 3-fluoropentane is CCC(F)CC.
What is the InChIKey of 3-fluoropentane?
The InChIKey is FBWYFZYJEAMPHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11F/c1-3-5(6)4-2/h5H,3-4H2,1-2H3.
What are the key properties of 3-fluoropentane?
3-fluoropentane has a molecular weight of 90.14 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoropentane is sourced from PubChem (CID 19428854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).