About [4-methyl-4-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate
[4-methyl-4-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate (PubChem CID 19429011) has the molecular formula C14H22O4
and a molecular weight of 254.33 g/mol. Its IUPAC name is [4-methyl-4-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [4-methyl-4-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate |
| PubChem CID | 19429011 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | [4-methyl-4-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(C)(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C14H22O4/c1-10(2)12(15)17-9-7-8-14(5,6)18-13(16)11(3)4/h1,3,7-9H2,2,4-6H3 |
| InChIKey | RNVBRRULAALBHT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [4-methyl-4-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-4-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate?
The IUPAC name of [4-methyl-4-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate (CID 19429011) is [4-methyl-4-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate.
What is the SMILES notation for [4-methyl-4-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate?
The canonical SMILES for [4-methyl-4-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate is C=C(C)C(=O)OCCCC(C)(C)OC(=O)C(=C)C.
What is the InChIKey of [4-methyl-4-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate?
The InChIKey is RNVBRRULAALBHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O4/c1-10(2)12(15)17-9-7-8-14(5,6)18-13(16)11(3)4/h1,3,7-9H2,2,4-6H3.
What are the key properties of [4-methyl-4-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate?
[4-methyl-4-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate has a molecular weight of 254.33 g/mol, XLogP of 2.78, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-4-(2-methylprop-2-enoyloxy)pentyl] 2-methylprop-2-enoate is sourced from PubChem (CID 19429011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).