About 1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-4H-chromeno[3,4-d]pyrazole
1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-4H-chromeno[3,4-d]pyrazole (PubChem CID 19429550) has the molecular formula C18H13F3N2O3S
and a molecular weight of 394.37 g/mol. Its IUPAC name is 1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-4H-chromeno[3,4-d]pyrazole.
Molecular Properties
| Compound Name | 1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-4H-chromeno[3,4-d]pyrazole |
| PubChem CID | 19429550 |
| Molecular Formula | C18H13F3N2O3S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-4H-chromeno[3,4-d]pyrazole |
| SMILES | CS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)c3c2-c2ccccc2OC3)cc1 |
| InChI | InChI=1S/C18H13F3N2O3S/c1-27(24,25)12-8-6-11(7-9-12)23-16-13-4-2-3-5-15(13)26-10-14(16)17(22-23)18(19,20)21/h2-9H,10H2,1H3 |
| InChIKey | VRLUPNCMLKXUOL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-4H-chromeno[3,4-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-4H-chromeno[3,4-d]pyrazole?
The IUPAC name of 1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-4H-chromeno[3,4-d]pyrazole (CID 19429550) is 1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-4H-chromeno[3,4-d]pyrazole.
What is the SMILES notation for 1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-4H-chromeno[3,4-d]pyrazole?
The canonical SMILES for 1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-4H-chromeno[3,4-d]pyrazole is CS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)c3c2-c2ccccc2OC3)cc1.
What is the InChIKey of 1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-4H-chromeno[3,4-d]pyrazole?
The InChIKey is VRLUPNCMLKXUOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F3N2O3S/c1-27(24,25)12-8-6-11(7-9-12)23-16-13-4-2-3-5-15(13)26-10-14(16)17(22-23)18(19,20)21/h2-9H,10H2,1H3.
What are the key properties of 1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-4H-chromeno[3,4-d]pyrazole?
1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-4H-chromeno[3,4-d]pyrazole has a molecular weight of 394.37 g/mol, XLogP of 3.85, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-4H-chromeno[3,4-d]pyrazole is sourced from PubChem (CID 19429550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).