About 3,4-bis(1H-indol-3-yl)-1-phenylmethoxypyrrole-2,5-dione
3,4-bis(1H-indol-3-yl)-1-phenylmethoxypyrrole-2,5-dione (PubChem CID 19429599) has the molecular formula C27H19N3O3
and a molecular weight of 433.47 g/mol. Its IUPAC name is 3,4-bis(1H-indol-3-yl)-1-phenylmethoxypyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3,4-bis(1H-indol-3-yl)-1-phenylmethoxypyrrole-2,5-dione |
| PubChem CID | 19429599 |
| Molecular Formula | C27H19N3O3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 3,4-bis(1H-indol-3-yl)-1-phenylmethoxypyrrole-2,5-dione |
| SMILES | O=C1C(c2c[nH]c3ccccc23)=C(c2c[nH]c3ccccc23)C(=O)N1OCc1ccccc1 |
| InChI | InChI=1S/C27H19N3O3/c31-26-24(20-14-28-22-12-6-4-10-18(20)22)25(21-15-29-23-13-7-5-11-19(21)23)27(32)30(26)33-16-17-8-2-1-3-9-17/h1-15,28-29H,16H2 |
| InChIKey | QWEIOZQBVVVHRB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 78.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(1H-indol-3-yl)-1-phenylmethoxypyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(1H-indol-3-yl)-1-phenylmethoxypyrrole-2,5-dione?
The IUPAC name of 3,4-bis(1H-indol-3-yl)-1-phenylmethoxypyrrole-2,5-dione (CID 19429599) is 3,4-bis(1H-indol-3-yl)-1-phenylmethoxypyrrole-2,5-dione.
What is the SMILES notation for 3,4-bis(1H-indol-3-yl)-1-phenylmethoxypyrrole-2,5-dione?
The canonical SMILES for 3,4-bis(1H-indol-3-yl)-1-phenylmethoxypyrrole-2,5-dione is O=C1C(c2c[nH]c3ccccc23)=C(c2c[nH]c3ccccc23)C(=O)N1OCc1ccccc1.
What is the InChIKey of 3,4-bis(1H-indol-3-yl)-1-phenylmethoxypyrrole-2,5-dione?
The InChIKey is QWEIOZQBVVVHRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19N3O3/c31-26-24(20-14-28-22-12-6-4-10-18(20)22)25(21-15-29-23-13-7-5-11-19(21)23)27(32)30(26)33-16-17-8-2-1-3-9-17/h1-15,28-29H,16H2.
What are the key properties of 3,4-bis(1H-indol-3-yl)-1-phenylmethoxypyrrole-2,5-dione?
3,4-bis(1H-indol-3-yl)-1-phenylmethoxypyrrole-2,5-dione has a molecular weight of 433.47 g/mol, XLogP of 5.06, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(1H-indol-3-yl)-1-phenylmethoxypyrrole-2,5-dione is sourced from PubChem (CID 19429599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).