About 2-butylbutanediamide
2-butylbutanediamide (PubChem CID 19430168) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-butylbutanediamide.
Molecular Properties
| Compound Name | 2-butylbutanediamide |
| PubChem CID | 19430168 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 2-butylbutanediamide |
| SMILES | CCCCC(CC(N)=O)C(N)=O |
| InChI | InChI=1S/C8H16N2O2/c1-2-3-4-6(8(10)12)5-7(9)11/h6H,2-5H2,1H3,(H2,9,11)(H2,10,12) |
| InChIKey | JWOGBVUDDPQHJV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylbutanediamide?
The IUPAC name of 2-butylbutanediamide (CID 19430168) is 2-butylbutanediamide.
What is the SMILES notation for 2-butylbutanediamide?
The canonical SMILES for 2-butylbutanediamide is CCCCC(CC(N)=O)C(N)=O.
What is the InChIKey of 2-butylbutanediamide?
The InChIKey is JWOGBVUDDPQHJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-2-3-4-6(8(10)12)5-7(9)11/h6H,2-5H2,1H3,(H2,9,11)(H2,10,12).
What are the key properties of 2-butylbutanediamide?
2-butylbutanediamide has a molecular weight of 172.23 g/mol, XLogP of 0.15, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylbutanediamide is sourced from PubChem (CID 19430168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).