C21H16F4N4O3 — CID 19430918
2-[6-fluoro-3-[4-(trifluoromethoxy)phenyl]benzotriazol-5-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 19430918) has the molecular formula C21H16F4N4O3 and a molecular weight of 448.38 g/mol. Its IUPAC name is 2-[6-fluoro-3-[4-(trifluoromethoxy)phenyl]benzotriazol-5-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 2-[6-fluoro-3-[4-(trifluoromethoxy)phenyl]benzotriazol-5-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 19430918 |
| Molecular Formula | C21H16F4N4O3 |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-[6-fluoro-3-[4-(trifluoromethoxy)phenyl]benzotriazol-5-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1C2CCCCC2C(=O)N1c1cc2c(cc1F)nnn2-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H16F4N4O3/c22-15-9-16-18(10-17(15)28-19(30)13-3-1-2-4-14(13)20(28)31)29(27-26-16)11-5-7-12(8-6-11)32-21(23,24)25/h5-10,13-14H,1-4H2 |
| InChIKey | QWUOMVALWONVFB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|