About 2,3,4,6-tetranitroaniline
2,3,4,6-tetranitroaniline (PubChem CID 19431) has the molecular formula C6H3N5O8
and a molecular weight of 273.12 g/mol. Its IUPAC name is 2,3,4,6-tetranitroaniline.
Molecular Properties
| Compound Name | 2,3,4,6-tetranitroaniline |
| PubChem CID | 19431 |
| Molecular Formula | C6H3N5O8 |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 2,3,4,6-tetranitroaniline |
| SMILES | Nc1c([N+](=O)[O-])cc([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H3N5O8/c7-4-2(8(12)13)1-3(9(14)15)5(10(16)17)6(4)11(18)19/h1H,7H2 |
| InChIKey | UKUDSMQEWVNCOJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 198.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4,6-tetranitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,6-tetranitroaniline?
The IUPAC name of 2,3,4,6-tetranitroaniline (CID 19431) is 2,3,4,6-tetranitroaniline.
What is the SMILES notation for 2,3,4,6-tetranitroaniline?
The canonical SMILES for 2,3,4,6-tetranitroaniline is Nc1c([N+](=O)[O-])cc([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-].
What is the InChIKey of 2,3,4,6-tetranitroaniline?
The InChIKey is UKUDSMQEWVNCOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N5O8/c7-4-2(8(12)13)1-3(9(14)15)5(10(16)17)6(4)11(18)19/h1H,7H2.
What are the key properties of 2,3,4,6-tetranitroaniline?
2,3,4,6-tetranitroaniline has a molecular weight of 273.12 g/mol, XLogP of 0.90, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,6-tetranitroaniline is sourced from PubChem (CID 19431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).