About 2-(3,4-difluorophenyl)-3-[1-(4-propylcyclohexyl)ethyl]benzoic acid
2-(3,4-difluorophenyl)-3-[1-(4-propylcyclohexyl)ethyl]benzoic acid (PubChem CID 19431190) has the molecular formula C24H28F2O2
and a molecular weight of 386.48 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-3-[1-(4-propylcyclohexyl)ethyl]benzoic acid.
Molecular Properties
| Compound Name | 2-(3,4-difluorophenyl)-3-[1-(4-propylcyclohexyl)ethyl]benzoic acid |
| PubChem CID | 19431190 |
| Molecular Formula | C24H28F2O2 |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-(3,4-difluorophenyl)-3-[1-(4-propylcyclohexyl)ethyl]benzoic acid |
| SMILES | CCCC1CCC(C(C)c2cccc(C(=O)O)c2-c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C24H28F2O2/c1-3-5-16-8-10-17(11-9-16)15(2)19-6-4-7-20(24(27)28)23(19)18-12-13-21(25)22(26)14-18/h4,6-7,12-17H,3,5,8-11H2,1-2H3,(H,27,28) |
| InChIKey | VKVQQRIYVACVRG-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,4-difluorophenyl)-3-[1-(4-propylcyclohexyl)ethyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-difluorophenyl)-3-[1-(4-propylcyclohexyl)ethyl]benzoic acid?
The IUPAC name of 2-(3,4-difluorophenyl)-3-[1-(4-propylcyclohexyl)ethyl]benzoic acid (CID 19431190) is 2-(3,4-difluorophenyl)-3-[1-(4-propylcyclohexyl)ethyl]benzoic acid.
What is the SMILES notation for 2-(3,4-difluorophenyl)-3-[1-(4-propylcyclohexyl)ethyl]benzoic acid?
The canonical SMILES for 2-(3,4-difluorophenyl)-3-[1-(4-propylcyclohexyl)ethyl]benzoic acid is CCCC1CCC(C(C)c2cccc(C(=O)O)c2-c2ccc(F)c(F)c2)CC1.
What is the InChIKey of 2-(3,4-difluorophenyl)-3-[1-(4-propylcyclohexyl)ethyl]benzoic acid?
The InChIKey is VKVQQRIYVACVRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28F2O2/c1-3-5-16-8-10-17(11-9-16)15(2)19-6-4-7-20(24(27)28)23(19)18-12-13-21(25)22(26)14-18/h4,6-7,12-17H,3,5,8-11H2,1-2H3,(H,27,28).
What are the key properties of 2-(3,4-difluorophenyl)-3-[1-(4-propylcyclohexyl)ethyl]benzoic acid?
2-(3,4-difluorophenyl)-3-[1-(4-propylcyclohexyl)ethyl]benzoic acid has a molecular weight of 386.48 g/mol, XLogP of 7.04, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-difluorophenyl)-3-[1-(4-propylcyclohexyl)ethyl]benzoic acid is sourced from PubChem (CID 19431190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).