About 2-[[4-(benzenesulfonyl)phenyl]methyl]-2,3-dimethyloxirane
2-[[4-(benzenesulfonyl)phenyl]methyl]-2,3-dimethyloxirane (PubChem CID 19431357) has the molecular formula C17H18O3S
and a molecular weight of 302.39 g/mol. Its IUPAC name is 2-[[4-(benzenesulfonyl)phenyl]methyl]-2,3-dimethyloxirane.
Molecular Properties
| Compound Name | 2-[[4-(benzenesulfonyl)phenyl]methyl]-2,3-dimethyloxirane |
| PubChem CID | 19431357 |
| Molecular Formula | C17H18O3S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-[[4-(benzenesulfonyl)phenyl]methyl]-2,3-dimethyloxirane |
| SMILES | CC1OC1(C)Cc1ccc(S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18O3S/c1-13-17(2,20-13)12-14-8-10-16(11-9-14)21(18,19)15-6-4-3-5-7-15/h3-11,13H,12H2,1-2H3 |
| InChIKey | DFVAZCCCSWZBPB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(benzenesulfonyl)phenyl]methyl]-2,3-dimethyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(benzenesulfonyl)phenyl]methyl]-2,3-dimethyloxirane?
The IUPAC name of 2-[[4-(benzenesulfonyl)phenyl]methyl]-2,3-dimethyloxirane (CID 19431357) is 2-[[4-(benzenesulfonyl)phenyl]methyl]-2,3-dimethyloxirane.
What is the SMILES notation for 2-[[4-(benzenesulfonyl)phenyl]methyl]-2,3-dimethyloxirane?
The canonical SMILES for 2-[[4-(benzenesulfonyl)phenyl]methyl]-2,3-dimethyloxirane is CC1OC1(C)Cc1ccc(S(=O)(=O)c2ccccc2)cc1.
What is the InChIKey of 2-[[4-(benzenesulfonyl)phenyl]methyl]-2,3-dimethyloxirane?
The InChIKey is DFVAZCCCSWZBPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O3S/c1-13-17(2,20-13)12-14-8-10-16(11-9-14)21(18,19)15-6-4-3-5-7-15/h3-11,13H,12H2,1-2H3.
What are the key properties of 2-[[4-(benzenesulfonyl)phenyl]methyl]-2,3-dimethyloxirane?
2-[[4-(benzenesulfonyl)phenyl]methyl]-2,3-dimethyloxirane has a molecular weight of 302.39 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(benzenesulfonyl)phenyl]methyl]-2,3-dimethyloxirane is sourced from PubChem (CID 19431357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).