C38H39N2O6P — CID 19431895
4,7-dibenzyl-1,3-bis[(4-hydroxyphenyl)methyl]-2-oxo-2-phenoxy-1,3,2λ5-diazaphosphepane-5,6-diol (PubChem CID 19431895) has the molecular formula C38H39N2O6P and a molecular weight of 650.71 g/mol. Its IUPAC name is 4,7-dibenzyl-1,3-bis[(4-hydroxyphenyl)methyl]-2-oxo-2-phenoxy-1,3,2λ5-diazaphosphepane-5,6-diol.
| Compound Name | 4,7-dibenzyl-1,3-bis[(4-hydroxyphenyl)methyl]-2-oxo-2-phenoxy-1,3,2λ5-diazaphosphepane-5,6-diol |
|---|---|
| PubChem CID | 19431895 |
| Molecular Formula | C38H39N2O6P |
| Molecular Weight | 650.71 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | 4,7-dibenzyl-1,3-bis[(4-hydroxyphenyl)methyl]-2-oxo-2-phenoxy-1,3,2λ5-diazaphosphepane-5,6-diol |
| SMILES | O=P1(Oc2ccccc2)N(Cc2ccc(O)cc2)C(Cc2ccccc2)C(O)C(O)C(Cc2ccccc2)N1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C38H39N2O6P/c41-32-20-16-30(17-21-32)26-39-35(24-28-10-4-1-5-11-28)37(43)38(44)36(25-29-12-6-2-7-13-29)40(27-31-18-22-33(42)23-19-31)47(39,45)46-34-14-8-3-9-15-34/h1-23,35-38,41-44H,24-27H2 |
| InChIKey | HLXQQRBJSQFPGA-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.71 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|