C16H11F4N3OS — CID 19431956
N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-thiophen-3-ylpyrimidin-2-amine (PubChem CID 19431956) has the molecular formula C16H11F4N3OS and a molecular weight of 369.34 g/mol. Its IUPAC name is N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-thiophen-3-ylpyrimidin-2-amine.
| Compound Name | N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-thiophen-3-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 19431956 |
| Molecular Formula | C16H11F4N3OS |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-thiophen-3-ylpyrimidin-2-amine |
| SMILES | FC(F)C(F)(F)Oc1cccc(Nc2nccc(-c3ccsc3)n2)c1 |
| InChI | InChI=1S/C16H11F4N3OS/c17-14(18)16(19,20)24-12-3-1-2-11(8-12)22-15-21-6-4-13(23-15)10-5-7-25-9-10/h1-9,14H,(H,21,22,23) |
| InChIKey | HDYQURRSTNGEEY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|