C6H12N2 — CID 19432557
1,3-dimethyl-2,4-dihydropyrimidine (PubChem CID 19432557) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dihydropyrimidine.
| Compound Name | 1,3-dimethyl-2,4-dihydropyrimidine |
|---|---|
| PubChem CID | 19432557 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 1,3-dimethyl-2,4-dihydropyrimidine |
| SMILES | CN1C=CCN(C)C1 |
| InChI | InChI=1S/C6H12N2/c1-7-4-3-5-8(2)6-7/h3-4H,5-6H2,1-2H3 |
| InChIKey | UPCMWHVBPPBFPF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |