C20H38N4O2 — CID 19433343
3,3,4,5,5-pentamethyl-1-[2-(3,3,4,5,5-pentamethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one (PubChem CID 19433343) has the molecular formula C20H38N4O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is 3,3,4,5,5-pentamethyl-1-[2-(3,3,4,5,5-pentamethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one.
| Compound Name | 3,3,4,5,5-pentamethyl-1-[2-(3,3,4,5,5-pentamethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 19433343 |
| Molecular Formula | C20H38N4O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | 3,3,4,5,5-pentamethyl-1-[2-(3,3,4,5,5-pentamethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one |
| SMILES | CN1C(C)(C)CN(CCN2CC(C)(C)N(C)C(C)(C)C2=O)C(=O)C1(C)C |
| InChI | InChI=1S/C20H38N4O2/c1-17(2)13-23(15(25)19(5,6)21(17)9)11-12-24-14-18(3,4)22(10)20(7,8)16(24)26/h11-14H2,1-10H3 |
| InChIKey | CMXAIAGONKHTHX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |