About magnesium;ethanolate;propan-2-olate
magnesium;ethanolate;propan-2-olate (PubChem CID 19433386) has the molecular formula C5H12MgO2
and a molecular weight of 128.45 g/mol. Its IUPAC name is magnesium;ethanolate;propan-2-olate.
Molecular Properties
| Compound Name | magnesium;ethanolate;propan-2-olate |
| PubChem CID | 19433386 |
| Molecular Formula | C5H12MgO2 |
| Molecular Weight | 128.45 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | magnesium;ethanolate;propan-2-olate |
| SMILES | CC(C)[O-].CC[O-].[Mg+2] |
| InChI | InChI=1S/C3H7O.C2H5O.Mg/c1-3(2)4;1-2-3;/h3H,1-2H3;2H2,1H3;/q2*-1;+2 |
| InChIKey | GZYFWIMHXDLFDM-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.45 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze magnesium;ethanolate;propan-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;ethanolate;propan-2-olate?
The IUPAC name of magnesium;ethanolate;propan-2-olate (CID 19433386) is magnesium;ethanolate;propan-2-olate.
What is the SMILES notation for magnesium;ethanolate;propan-2-olate?
The canonical SMILES for magnesium;ethanolate;propan-2-olate is CC(C)[O-].CC[O-].[Mg+2].
What is the InChIKey of magnesium;ethanolate;propan-2-olate?
The InChIKey is GZYFWIMHXDLFDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O.C2H5O.Mg/c1-3(2)4;1-2-3;/h3H,1-2H3;2H2,1H3;/q2*-1;+2.
What are the key properties of magnesium;ethanolate;propan-2-olate?
magnesium;ethanolate;propan-2-olate has a molecular weight of 128.45 g/mol, XLogP of -1.26, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;ethanolate;propan-2-olate is sourced from PubChem (CID 19433386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).