About butane-1,1-diol;methanediol
butane-1,1-diol;methanediol (PubChem CID 19433394) has the molecular formula C5H14O4
and a molecular weight of 138.16 g/mol. Its IUPAC name is butane-1,1-diol;methanediol.
Molecular Properties
| Compound Name | butane-1,1-diol;methanediol |
| PubChem CID | 19433394 |
| Molecular Formula | C5H14O4 |
| Molecular Weight | 138.16 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | butane-1,1-diol;methanediol |
| SMILES | CCCC(O)O.OCO |
| InChI | InChI=1S/C4H10O2.CH4O2/c1-2-3-4(5)6;2-1-3/h4-6H,2-3H2,1H3;2-3H,1H2 |
| InChIKey | VWSRIEFRUVHPSL-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.16 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze butane-1,1-diol;methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,1-diol;methanediol?
The IUPAC name of butane-1,1-diol;methanediol (CID 19433394) is butane-1,1-diol;methanediol.
What is the SMILES notation for butane-1,1-diol;methanediol?
The canonical SMILES for butane-1,1-diol;methanediol is CCCC(O)O.OCO.
What is the InChIKey of butane-1,1-diol;methanediol?
The InChIKey is VWSRIEFRUVHPSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.CH4O2/c1-2-3-4(5)6;2-1-3/h4-6H,2-3H2,1H3;2-3H,1H2.
What are the key properties of butane-1,1-diol;methanediol?
butane-1,1-diol;methanediol has a molecular weight of 138.16 g/mol, XLogP of -0.97, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,1-diol;methanediol is sourced from PubChem (CID 19433394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).