About methanediol;propane-1,1-diol
methanediol;propane-1,1-diol (PubChem CID 19433398) has the molecular formula C4H12O4
and a molecular weight of 124.14 g/mol. Its IUPAC name is methanediol;propane-1,1-diol.
Molecular Properties
| Compound Name | methanediol;propane-1,1-diol |
| PubChem CID | 19433398 |
| Molecular Formula | C4H12O4 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | methanediol;propane-1,1-diol |
| SMILES | CCC(O)O.OCO |
| InChI | InChI=1S/C3H8O2.CH4O2/c1-2-3(4)5;2-1-3/h3-5H,2H2,1H3;2-3H,1H2 |
| InChIKey | RTQPSWNFCXXBGL-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methanediol;propane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanediol;propane-1,1-diol?
The IUPAC name of methanediol;propane-1,1-diol (CID 19433398) is methanediol;propane-1,1-diol.
What is the SMILES notation for methanediol;propane-1,1-diol?
The canonical SMILES for methanediol;propane-1,1-diol is CCC(O)O.OCO.
What is the InChIKey of methanediol;propane-1,1-diol?
The InChIKey is RTQPSWNFCXXBGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.CH4O2/c1-2-3(4)5;2-1-3/h3-5H,2H2,1H3;2-3H,1H2.
What are the key properties of methanediol;propane-1,1-diol?
methanediol;propane-1,1-diol has a molecular weight of 124.14 g/mol, XLogP of -1.36, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanediol;propane-1,1-diol is sourced from PubChem (CID 19433398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).