About imidazo[4,5-b]quinolin-2-one
imidazo[4,5-b]quinolin-2-one (PubChem CID 19433527) has the molecular formula C10H5N3O
and a molecular weight of 183.17 g/mol. Its IUPAC name is imidazo[4,5-b]quinolin-2-one.
Molecular Properties
| Compound Name | imidazo[4,5-b]quinolin-2-one |
| PubChem CID | 19433527 |
| Molecular Formula | C10H5N3O |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | imidazo[4,5-b]quinolin-2-one |
| SMILES | O=C1N=c2cc3ccccc3nc2=N1 |
| InChI | InChI=1S/C10H5N3O/c14-10-12-8-5-6-3-1-2-4-7(6)11-9(8)13-10/h1-5H |
| InChIKey | PZVFRCCIJOLDRB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze imidazo[4,5-b]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[4,5-b]quinolin-2-one?
The IUPAC name of imidazo[4,5-b]quinolin-2-one (CID 19433527) is imidazo[4,5-b]quinolin-2-one.
What is the SMILES notation for imidazo[4,5-b]quinolin-2-one?
The canonical SMILES for imidazo[4,5-b]quinolin-2-one is O=C1N=c2cc3ccccc3nc2=N1.
What is the InChIKey of imidazo[4,5-b]quinolin-2-one?
The InChIKey is PZVFRCCIJOLDRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5N3O/c14-10-12-8-5-6-3-1-2-4-7(6)11-9(8)13-10/h1-5H.
What are the key properties of imidazo[4,5-b]quinolin-2-one?
imidazo[4,5-b]quinolin-2-one has a molecular weight of 183.17 g/mol, XLogP of 0.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[4,5-b]quinolin-2-one is sourced from PubChem (CID 19433527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).