C19H19N3O5 — CID 19433542
5-[[2-amino-5-(3,4-dimethoxybenzoyl)phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 19433542) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is 5-[[2-amino-5-(3,4-dimethoxybenzoyl)phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[[2-amino-5-(3,4-dimethoxybenzoyl)phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 19433542 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 5-[[2-amino-5-(3,4-dimethoxybenzoyl)phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(C(=O)c2ccc(N)c(CC3NC(=O)NC3=O)c2)cc1OC |
| InChI | InChI=1S/C19H19N3O5/c1-26-15-6-4-11(9-16(15)27-2)17(23)10-3-5-13(20)12(7-10)8-14-18(24)22-19(25)21-14/h3-7,9,14H,8,20H2,1-2H3,(H2,21,22,24,25) |
| InChIKey | GZBJMLRZYHAQDX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|