C21H36O3 — CID 19433704
3,7-dimethylocta-1,6-dien-3-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate (PubChem CID 19433704) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is 3,7-dimethylocta-1,6-dien-3-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate.
| Compound Name | 3,7-dimethylocta-1,6-dien-3-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate |
|---|---|
| PubChem CID | 19433704 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | 3,7-dimethylocta-1,6-dien-3-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate |
| SMILES | C=CC(C)(CCC=C(C)C)OC(=O)OC1CCCC(C)(C(C)C)C1 |
| InChI | InChI=1S/C21H36O3/c1-8-21(7,14-9-11-16(2)3)24-19(22)23-18-12-10-13-20(6,15-18)17(4)5/h8,11,17-18H,1,9-10,12-15H2,2-7H3 |
| InChIKey | UFEQCXGHTWMEQJ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|