About 5-(4-chlorobutanoylamino)-3-ethyl-1,2-thiazole-4-carboxamide
5-(4-chlorobutanoylamino)-3-ethyl-1,2-thiazole-4-carboxamide (PubChem CID 19433814) has the molecular formula C10H14ClN3O2S
and a molecular weight of 275.76 g/mol. Its IUPAC name is 5-(4-chlorobutanoylamino)-3-ethyl-1,2-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-(4-chlorobutanoylamino)-3-ethyl-1,2-thiazole-4-carboxamide |
| PubChem CID | 19433814 |
| Molecular Formula | C10H14ClN3O2S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 5-(4-chlorobutanoylamino)-3-ethyl-1,2-thiazole-4-carboxamide |
| SMILES | CCc1nsc(NC(=O)CCCCl)c1C(N)=O |
| InChI | InChI=1S/C10H14ClN3O2S/c1-2-6-8(9(12)16)10(17-14-6)13-7(15)4-3-5-11/h2-5H2,1H3,(H2,12,16)(H,13,15) |
| InChIKey | CFVHJWQBHDFNOV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-chlorobutanoylamino)-3-ethyl-1,2-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorobutanoylamino)-3-ethyl-1,2-thiazole-4-carboxamide?
The IUPAC name of 5-(4-chlorobutanoylamino)-3-ethyl-1,2-thiazole-4-carboxamide (CID 19433814) is 5-(4-chlorobutanoylamino)-3-ethyl-1,2-thiazole-4-carboxamide.
What is the SMILES notation for 5-(4-chlorobutanoylamino)-3-ethyl-1,2-thiazole-4-carboxamide?
The canonical SMILES for 5-(4-chlorobutanoylamino)-3-ethyl-1,2-thiazole-4-carboxamide is CCc1nsc(NC(=O)CCCCl)c1C(N)=O.
What is the InChIKey of 5-(4-chlorobutanoylamino)-3-ethyl-1,2-thiazole-4-carboxamide?
The InChIKey is CFVHJWQBHDFNOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN3O2S/c1-2-6-8(9(12)16)10(17-14-6)13-7(15)4-3-5-11/h2-5H2,1H3,(H2,12,16)(H,13,15).
What are the key properties of 5-(4-chlorobutanoylamino)-3-ethyl-1,2-thiazole-4-carboxamide?
5-(4-chlorobutanoylamino)-3-ethyl-1,2-thiazole-4-carboxamide has a molecular weight of 275.76 g/mol, XLogP of 1.76, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorobutanoylamino)-3-ethyl-1,2-thiazole-4-carboxamide is sourced from PubChem (CID 19433814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).