C27H34F3NO6 — CID 19434227
ethyl 3-hexyl-4-[[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trifluoroacetyl)amino]-1H-2-benzofuran-5-yl]methyl]cyclopent-3-ene-1-carboxylate (PubChem CID 19434227) has the molecular formula C27H34F3NO6 and a molecular weight of 525.56 g/mol. Its IUPAC name is ethyl 3-hexyl-4-[[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trifluoroacetyl)amino]-1H-2-benzofuran-5-yl]methyl]cyclopent-3-ene-1-carboxylate.
| Compound Name | ethyl 3-hexyl-4-[[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trifluoroacetyl)amino]-1H-2-benzofuran-5-yl]methyl]cyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 19434227 |
| Molecular Formula | C27H34F3NO6 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | ethyl 3-hexyl-4-[[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trifluoroacetyl)amino]-1H-2-benzofuran-5-yl]methyl]cyclopent-3-ene-1-carboxylate |
| SMILES | CCCCCCC1=C(Cc2c(NC(=O)C(F)(F)F)c3c(c(C)c2OC)COC3=O)CC(C(=O)OCC)C1 |
| InChI | InChI=1S/C27H34F3NO6/c1-5-7-8-9-10-16-11-18(24(32)36-6-2)12-17(16)13-19-22(31-26(34)27(28,29)30)21-20(14-37-25(21)33)15(3)23(19)35-4/h18H,5-14H2,1-4H3,(H,31,34) |
| InChIKey | SEDUMCLUMINCSD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|