C13H12F2NO3- — CID 19434518
2-[(5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)-formylamino]acetate (PubChem CID 19434518) has the molecular formula C13H12F2NO3- and a molecular weight of 268.24 g/mol. Its IUPAC name is 2-[(5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)-formylamino]acetate.
| Compound Name | 2-[(5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)-formylamino]acetate |
|---|---|
| PubChem CID | 19434518 |
| Molecular Formula | C13H12F2NO3- |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-[(5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)-formylamino]acetate |
| SMILES | O=CN(CC(=O)[O-])C1CCc2c(F)cc(F)cc2C1 |
| InChI | InChI=1S/C13H13F2NO3/c14-9-3-8-4-10(16(7-17)6-13(18)19)1-2-11(8)12(15)5-9/h3,5,7,10H,1-2,4,6H2,(H,18,19)/p-1 |
| InChIKey | LTIPZUAKDIGFHQ-UHFFFAOYSA-M |
| XLogP | 0.03 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|