C16H28N6O5 — CID 19434755
3-[[2-[3-[3-(diaminomethylideneamino)propyl]-4-methyl-2,5-dioxo-1,4-diazocan-1-yl]acetyl]amino]propanoic acid (PubChem CID 19434755) has the molecular formula C16H28N6O5 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-[[2-[3-[3-(diaminomethylideneamino)propyl]-4-methyl-2,5-dioxo-1,4-diazocan-1-yl]acetyl]amino]propanoic acid.
| Compound Name | 3-[[2-[3-[3-(diaminomethylideneamino)propyl]-4-methyl-2,5-dioxo-1,4-diazocan-1-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 19434755 |
| Molecular Formula | C16H28N6O5 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 3-[[2-[3-[3-(diaminomethylideneamino)propyl]-4-methyl-2,5-dioxo-1,4-diazocan-1-yl]acetyl]amino]propanoic acid |
| SMILES | CN1C(=O)CCCN(CC(=O)NCCC(=O)O)C(=O)C1CCCN=C(N)N |
| InChI | InChI=1S/C16H28N6O5/c1-21-11(4-2-7-20-16(17)18)15(27)22(9-3-5-13(21)24)10-12(23)19-8-6-14(25)26/h11H,2-10H2,1H3,(H,19,23)(H,25,26)(H4,17,18,20) |
| InChIKey | AGRCQABVBBSWIE-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 171.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|