C14H26N4O3 — CID 19434767
7-[2-(1,3-dioxol-2-yl)ethyl]-1,4,7,10-tetrazacyclododecane-1-carbaldehyde (PubChem CID 19434767) has the molecular formula C14H26N4O3 and a molecular weight of 298.39 g/mol. Its IUPAC name is 7-[2-(1,3-dioxol-2-yl)ethyl]-1,4,7,10-tetrazacyclododecane-1-carbaldehyde.
| Compound Name | 7-[2-(1,3-dioxol-2-yl)ethyl]-1,4,7,10-tetrazacyclododecane-1-carbaldehyde |
|---|---|
| PubChem CID | 19434767 |
| Molecular Formula | C14H26N4O3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 7-[2-(1,3-dioxol-2-yl)ethyl]-1,4,7,10-tetrazacyclododecane-1-carbaldehyde |
| SMILES | O=CN1CCNCCN(CCC2OC=CO2)CCNCC1 |
| InChI | InChI=1S/C14H26N4O3/c19-13-18-9-4-15-2-7-17(8-3-16-5-10-18)6-1-14-20-11-12-21-14/h11-16H,1-10H2 |
| InChIKey | FTGTUNOPTXHANT-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|