C23H22ClF3N2O3 — CID 19434997
N-[4-[5-(3-chloropropylamino)-6,8-difluoro-4-oxochromen-2-yl]-2-fluorophenyl]-2,2-dimethylpropanamide (PubChem CID 19434997) has the molecular formula C23H22ClF3N2O3 and a molecular weight of 466.89 g/mol. Its IUPAC name is N-[4-[5-(3-chloropropylamino)-6,8-difluoro-4-oxochromen-2-yl]-2-fluorophenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[5-(3-chloropropylamino)-6,8-difluoro-4-oxochromen-2-yl]-2-fluorophenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 19434997 |
| Molecular Formula | C23H22ClF3N2O3 |
| Molecular Weight | 466.89 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | N-[4-[5-(3-chloropropylamino)-6,8-difluoro-4-oxochromen-2-yl]-2-fluorophenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(-c2cc(=O)c3c(NCCCCl)c(F)cc(F)c3o2)cc1F |
| InChI | InChI=1S/C23H22ClF3N2O3/c1-23(2,3)22(31)29-16-6-5-12(9-13(16)25)18-11-17(30)19-20(28-8-4-7-24)14(26)10-15(27)21(19)32-18/h5-6,9-11,28H,4,7-8H2,1-3H3,(H,29,31) |
| InChIKey | XCTKZFHULXNRMB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.89 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|