C26H27F3N2O5 — CID 19435006
ethyl 4-[[2-[4-(2,2-dimethylpropanoylamino)-3-fluorophenyl]-6,8-difluoro-4-oxochromen-5-yl]amino]butanoate (PubChem CID 19435006) has the molecular formula C26H27F3N2O5 and a molecular weight of 504.51 g/mol. Its IUPAC name is ethyl 4-[[2-[4-(2,2-dimethylpropanoylamino)-3-fluorophenyl]-6,8-difluoro-4-oxochromen-5-yl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[4-(2,2-dimethylpropanoylamino)-3-fluorophenyl]-6,8-difluoro-4-oxochromen-5-yl]amino]butanoate |
|---|---|
| PubChem CID | 19435006 |
| Molecular Formula | C26H27F3N2O5 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | ethyl 4-[[2-[4-(2,2-dimethylpropanoylamino)-3-fluorophenyl]-6,8-difluoro-4-oxochromen-5-yl]amino]butanoate |
| SMILES | CCOC(=O)CCCNc1c(F)cc(F)c2oc(-c3ccc(NC(=O)C(C)(C)C)c(F)c3)cc(=O)c12 |
| InChI | InChI=1S/C26H27F3N2O5/c1-5-35-21(33)7-6-10-30-23-16(28)12-17(29)24-22(23)19(32)13-20(36-24)14-8-9-18(15(27)11-14)31-25(34)26(2,3)4/h8-9,11-13,30H,5-7,10H2,1-4H3,(H,31,34) |
| InChIKey | KFTOONBNGYRFKV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|