C26H29FN2O — CID 19435078
3-[2-(cyclopropylmethyl)-8-fluoro-6-methyl-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazol-4a-yl]phenol (PubChem CID 19435078) has the molecular formula C26H29FN2O and a molecular weight of 404.53 g/mol. Its IUPAC name is 3-[2-(cyclopropylmethyl)-8-fluoro-6-methyl-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazol-4a-yl]phenol.
| Compound Name | 3-[2-(cyclopropylmethyl)-8-fluoro-6-methyl-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazol-4a-yl]phenol |
|---|---|
| PubChem CID | 19435078 |
| Molecular Formula | C26H29FN2O |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 3-[2-(cyclopropylmethyl)-8-fluoro-6-methyl-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazol-4a-yl]phenol |
| SMILES | Cn1c2c(c3ccc(F)cc31)CC1CN(CC3CC3)CCC1(c1cccc(O)c1)C2 |
| InChI | InChI=1S/C26H29FN2O/c1-28-24-13-20(27)7-8-22(24)23-12-19-16-29(15-17-5-6-17)10-9-26(19,14-25(23)28)18-3-2-4-21(30)11-18/h2-4,7-8,11,13,17,19,30H,5-6,9-10,12,14-16H2,1H3 |
| InChIKey | OKHDZBCMYVRESX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|