C24H27FN2O — CID 19435163
9-fluoro-4a-(3-methoxyphenyl)-2,6-dimethyl-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazole (PubChem CID 19435163) has the molecular formula C24H27FN2O and a molecular weight of 378.49 g/mol. Its IUPAC name is 9-fluoro-4a-(3-methoxyphenyl)-2,6-dimethyl-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazole.
| Compound Name | 9-fluoro-4a-(3-methoxyphenyl)-2,6-dimethyl-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazole |
|---|---|
| PubChem CID | 19435163 |
| Molecular Formula | C24H27FN2O |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 9-fluoro-4a-(3-methoxyphenyl)-2,6-dimethyl-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazole |
| SMILES | COc1cccc(C23CCN(C)CC2Cc2c(n(C)c4ccc(F)cc24)C3)c1 |
| InChI | InChI=1S/C24H27FN2O/c1-26-10-9-24(16-5-4-6-19(11-16)28-3)14-23-20(12-17(24)15-26)21-13-18(25)7-8-22(21)27(23)2/h4-8,11,13,17H,9-10,12,14-15H2,1-3H3 |
| InChIKey | SEAWWHKCOUOSHP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|