C28H27FN2O2 — CID 19435270
2-benzyl-10-fluoro-4a-(3-hydroxyphenyl)-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol (PubChem CID 19435270) has the molecular formula C28H27FN2O2 and a molecular weight of 442.53 g/mol. Its IUPAC name is 2-benzyl-10-fluoro-4a-(3-hydroxyphenyl)-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol.
| Compound Name | 2-benzyl-10-fluoro-4a-(3-hydroxyphenyl)-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol |
|---|---|
| PubChem CID | 19435270 |
| Molecular Formula | C28H27FN2O2 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-benzyl-10-fluoro-4a-(3-hydroxyphenyl)-1,3,4,5,6,11-hexahydropyrido[4,3-b]carbazol-11a-ol |
| SMILES | Oc1cccc(C23CCN(Cc4ccccc4)CC2(O)Cc2c([nH]c4cccc(F)c24)C3)c1 |
| InChI | InChI=1S/C28H27FN2O2/c29-23-10-5-11-24-26(23)22-15-28(33)18-31(17-19-6-2-1-3-7-19)13-12-27(28,16-25(22)30-24)20-8-4-9-21(32)14-20/h1-11,14,30,32-33H,12-13,15-18H2 |
| InChIKey | CSHFYIKVJLGZRG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |