C24H25N3O3 — CID 19435436
3-(8-nitro-2-prop-2-enyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl)phenol (PubChem CID 19435436) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 3-(8-nitro-2-prop-2-enyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl)phenol.
| Compound Name | 3-(8-nitro-2-prop-2-enyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl)phenol |
|---|---|
| PubChem CID | 19435436 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 3-(8-nitro-2-prop-2-enyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-4a-yl)phenol |
| SMILES | C=CCN1CCC2(c3cccc(O)c3)Cc3[nH]c4cc([N+](=O)[O-])ccc4c3CC2C1 |
| InChI | InChI=1S/C24H25N3O3/c1-2-9-26-10-8-24(16-4-3-5-19(28)11-16)14-23-21(12-17(24)15-26)20-7-6-18(27(29)30)13-22(20)25-23/h2-7,11,13,17,25,28H,1,8-10,12,14-15H2 |
| InChIKey | XOLUHFXZYTXSOG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 82.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|