About 4-(2,3-dihydropyrrol-1-yl)-3-methyl-4H-1,2-oxazol-5-one
4-(2,3-dihydropyrrol-1-yl)-3-methyl-4H-1,2-oxazol-5-one (PubChem CID 19436655) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 4-(2,3-dihydropyrrol-1-yl)-3-methyl-4H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 4-(2,3-dihydropyrrol-1-yl)-3-methyl-4H-1,2-oxazol-5-one |
| PubChem CID | 19436655 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 4-(2,3-dihydropyrrol-1-yl)-3-methyl-4H-1,2-oxazol-5-one |
| SMILES | CC1=NOC(=O)C1N1C=CCC1 |
| InChI | InChI=1S/C8H10N2O2/c1-6-7(8(11)12-9-6)10-4-2-3-5-10/h2,4,7H,3,5H2,1H3 |
| InChIKey | CWKMWVZIJFIZNF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dihydropyrrol-1-yl)-3-methyl-4H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dihydropyrrol-1-yl)-3-methyl-4H-1,2-oxazol-5-one?
The IUPAC name of 4-(2,3-dihydropyrrol-1-yl)-3-methyl-4H-1,2-oxazol-5-one (CID 19436655) is 4-(2,3-dihydropyrrol-1-yl)-3-methyl-4H-1,2-oxazol-5-one.
What is the SMILES notation for 4-(2,3-dihydropyrrol-1-yl)-3-methyl-4H-1,2-oxazol-5-one?
The canonical SMILES for 4-(2,3-dihydropyrrol-1-yl)-3-methyl-4H-1,2-oxazol-5-one is CC1=NOC(=O)C1N1C=CCC1.
What is the InChIKey of 4-(2,3-dihydropyrrol-1-yl)-3-methyl-4H-1,2-oxazol-5-one?
The InChIKey is CWKMWVZIJFIZNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-6-7(8(11)12-9-6)10-4-2-3-5-10/h2,4,7H,3,5H2,1H3.
What are the key properties of 4-(2,3-dihydropyrrol-1-yl)-3-methyl-4H-1,2-oxazol-5-one?
4-(2,3-dihydropyrrol-1-yl)-3-methyl-4H-1,2-oxazol-5-one has a molecular weight of 166.18 g/mol, XLogP of 0.51, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydropyrrol-1-yl)-3-methyl-4H-1,2-oxazol-5-one is sourced from PubChem (CID 19436655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).