C11H15N5O — CID 19436890
(2,4-diamino-5-propylpyrido[2,3-d]pyrimidin-6-yl)methanol (PubChem CID 19436890) has the molecular formula C11H15N5O and a molecular weight of 233.27 g/mol. Its IUPAC name is (2,4-diamino-5-propylpyrido[2,3-d]pyrimidin-6-yl)methanol.
| Compound Name | (2,4-diamino-5-propylpyrido[2,3-d]pyrimidin-6-yl)methanol |
|---|---|
| PubChem CID | 19436890 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | (2,4-diamino-5-propylpyrido[2,3-d]pyrimidin-6-yl)methanol |
| SMILES | CCCc1c(CO)cnc2nc(N)nc(N)c12 |
| InChI | InChI=1S/C11H15N5O/c1-2-3-7-6(5-17)4-14-10-8(7)9(12)15-11(13)16-10/h4,17H,2-3,5H2,1H3,(H4,12,13,14,15,16) |
| InChIKey | GDDOBDUGMHCRKQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |