C15H10N4O2 — CID 19436949
5-phenyl-1,3-dihydroimidazo[4,5-c][1,8]naphthyridine-2,4-dione (PubChem CID 19436949) has the molecular formula C15H10N4O2 and a molecular weight of 278.27 g/mol. Its IUPAC name is 5-phenyl-1,3-dihydroimidazo[4,5-c][1,8]naphthyridine-2,4-dione.
| Compound Name | 5-phenyl-1,3-dihydroimidazo[4,5-c][1,8]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 19436949 |
| Molecular Formula | C15H10N4O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 5-phenyl-1,3-dihydroimidazo[4,5-c][1,8]naphthyridine-2,4-dione |
| SMILES | O=c1[nH]c2c(=O)n(-c3ccccc3)c3ncccc3c2[nH]1 |
| InChI | InChI=1S/C15H10N4O2/c20-14-12-11(17-15(21)18-12)10-7-4-8-16-13(10)19(14)9-5-2-1-3-6-9/h1-8H,(H2,17,18,21) |
| InChIKey | WACUUCQTUMASJD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |