About 2-(3,6-dihydro-2H-pyran-6-ylmethoxy)-6-ethylpyridine
2-(3,6-dihydro-2H-pyran-6-ylmethoxy)-6-ethylpyridine (PubChem CID 19437036) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyran-6-ylmethoxy)-6-ethylpyridine.
Molecular Properties
| Compound Name | 2-(3,6-dihydro-2H-pyran-6-ylmethoxy)-6-ethylpyridine |
| PubChem CID | 19437036 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyran-6-ylmethoxy)-6-ethylpyridine |
| SMILES | CCc1cccc(OCC2C=CCCO2)n1 |
| InChI | InChI=1S/C13H17NO2/c1-2-11-6-5-8-13(14-11)16-10-12-7-3-4-9-15-12/h3,5-8,12H,2,4,9-10H2,1H3 |
| InChIKey | KYRGVMZRDJVTDM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,6-dihydro-2H-pyran-6-ylmethoxy)-6-ethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,6-dihydro-2H-pyran-6-ylmethoxy)-6-ethylpyridine?
The IUPAC name of 2-(3,6-dihydro-2H-pyran-6-ylmethoxy)-6-ethylpyridine (CID 19437036) is 2-(3,6-dihydro-2H-pyran-6-ylmethoxy)-6-ethylpyridine.
What is the SMILES notation for 2-(3,6-dihydro-2H-pyran-6-ylmethoxy)-6-ethylpyridine?
The canonical SMILES for 2-(3,6-dihydro-2H-pyran-6-ylmethoxy)-6-ethylpyridine is CCc1cccc(OCC2C=CCCO2)n1.
What is the InChIKey of 2-(3,6-dihydro-2H-pyran-6-ylmethoxy)-6-ethylpyridine?
The InChIKey is KYRGVMZRDJVTDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-2-11-6-5-8-13(14-11)16-10-12-7-3-4-9-15-12/h3,5-8,12H,2,4,9-10H2,1H3.
What are the key properties of 2-(3,6-dihydro-2H-pyran-6-ylmethoxy)-6-ethylpyridine?
2-(3,6-dihydro-2H-pyran-6-ylmethoxy)-6-ethylpyridine has a molecular weight of 219.28 g/mol, XLogP of 2.37, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dihydro-2H-pyran-6-ylmethoxy)-6-ethylpyridine is sourced from PubChem (CID 19437036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).