About imidazo[4,5-e]quinoxaline
imidazo[4,5-e]quinoxaline (PubChem CID 19437655) has the molecular formula C9H6N4
and a molecular weight of 170.18 g/mol. Its IUPAC name is imidazo[4,5-e]quinoxaline.
Molecular Properties
| Compound Name | imidazo[4,5-e]quinoxaline |
| PubChem CID | 19437655 |
| Molecular Formula | C9H6N4 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | imidazo[4,5-e]quinoxaline |
| SMILES | C1=CC2=NC=NC23N=CC=NC3=C1 |
| InChI | InChI=1S/C9H6N4/c1-2-7-9(12-5-4-10-7)8(3-1)11-6-13-9/h1-6H |
| InChIKey | QPMJQZOFEMTSCG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze imidazo[4,5-e]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[4,5-e]quinoxaline?
The IUPAC name of imidazo[4,5-e]quinoxaline (CID 19437655) is imidazo[4,5-e]quinoxaline.
What is the SMILES notation for imidazo[4,5-e]quinoxaline?
The canonical SMILES for imidazo[4,5-e]quinoxaline is C1=CC2=NC=NC23N=CC=NC3=C1.
What is the InChIKey of imidazo[4,5-e]quinoxaline?
The InChIKey is QPMJQZOFEMTSCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N4/c1-2-7-9(12-5-4-10-7)8(3-1)11-6-13-9/h1-6H.
What are the key properties of imidazo[4,5-e]quinoxaline?
imidazo[4,5-e]quinoxaline has a molecular weight of 170.18 g/mol, XLogP of 0.77, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[4,5-e]quinoxaline is sourced from PubChem (CID 19437655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).