About 3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile
3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile (PubChem CID 19437894) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile.
Molecular Properties
| Compound Name | 3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile |
| PubChem CID | 19437894 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile |
| SMILES | N#CC1C2CC3CC1N(C3)C2 |
| InChI | InChI=1S/C9H12N2/c10-3-8-7-1-6-2-9(8)11(4-6)5-7/h6-9H,1-2,4-5H2 |
| InChIKey | BAIOZIDJWYMNJS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile?
The IUPAC name of 3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile (CID 19437894) is 3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile.
What is the SMILES notation for 3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile?
The canonical SMILES for 3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile is N#CC1C2CC3CC1N(C3)C2.
What is the InChIKey of 3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile?
The InChIKey is BAIOZIDJWYMNJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c10-3-8-7-1-6-2-9(8)11(4-6)5-7/h6-9H,1-2,4-5H2.
What are the key properties of 3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile?
3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile has a molecular weight of 148.21 g/mol, XLogP of 0.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azatricyclo[3.3.1.03,7]nonane-6-carbonitrile is sourced from PubChem (CID 19437894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).