C38H59O3P — CID 19438147
[hexyl-[2,4,6-tri(propan-2-yl)benzoyl]phosphoryl]-[2,4,6-tri(propan-2-yl)phenyl]methanone (PubChem CID 19438147) has the molecular formula C38H59O3P and a molecular weight of 594.86 g/mol. Its IUPAC name is [hexyl-[2,4,6-tri(propan-2-yl)benzoyl]phosphoryl]-[2,4,6-tri(propan-2-yl)phenyl]methanone.
| Compound Name | [hexyl-[2,4,6-tri(propan-2-yl)benzoyl]phosphoryl]-[2,4,6-tri(propan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 19438147 |
| Molecular Formula | C38H59O3P |
| Molecular Weight | 594.86 g/mol |
| Exact Mass | 594.42 |
| IUPAC Name | [hexyl-[2,4,6-tri(propan-2-yl)benzoyl]phosphoryl]-[2,4,6-tri(propan-2-yl)phenyl]methanone |
| SMILES | CCCCCCP(=O)(C(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C)C(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C38H59O3P/c1-14-15-16-17-18-42(41,37(39)35-31(25(6)7)19-29(23(2)3)20-32(35)26(8)9)38(40)36-33(27(10)11)21-30(24(4)5)22-34(36)28(12)13/h19-28H,14-18H2,1-13H3 |
| InChIKey | OEZSFDSKWVDKNP-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.86 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|