C15H30N4O6P2 — CID 19438218
N-butyl-4,6-bis(diethoxyphosphoryl)-1,3,5-triazin-2-amine (PubChem CID 19438218) has the molecular formula C15H30N4O6P2 and a molecular weight of 424.38 g/mol. Its IUPAC name is N-butyl-4,6-bis(diethoxyphosphoryl)-1,3,5-triazin-2-amine.
| Compound Name | N-butyl-4,6-bis(diethoxyphosphoryl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 19438218 |
| Molecular Formula | C15H30N4O6P2 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-butyl-4,6-bis(diethoxyphosphoryl)-1,3,5-triazin-2-amine |
| SMILES | CCCCNc1nc(P(=O)(OCC)OCC)nc(P(=O)(OCC)OCC)n1 |
| InChI | InChI=1S/C15H30N4O6P2/c1-6-11-12-16-13-17-14(26(20,22-7-2)23-8-3)19-15(18-13)27(21,24-9-4)25-10-5/h6-12H2,1-5H3,(H,16,17,18,19) |
| InChIKey | MPQNJSSYXGPFGU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|