About 1,2,2-trifluoroethanethiol
1,2,2-trifluoroethanethiol (PubChem CID 19438382) has the molecular formula C2H3F3S
and a molecular weight of 116.11 g/mol. Its IUPAC name is 1,2,2-trifluoroethanethiol.
Molecular Properties
| Compound Name | 1,2,2-trifluoroethanethiol |
| PubChem CID | 19438382 |
| Molecular Formula | C2H3F3S |
| Molecular Weight | 116.11 g/mol |
| Exact Mass | 115.99 |
| IUPAC Name | 1,2,2-trifluoroethanethiol |
| SMILES | FC(F)C(F)S |
| InChI | InChI=1S/C2H3F3S/c3-1(4)2(5)6/h1-2,6H |
| InChIKey | LOIOGJZURNOUDO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.11 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2,2-trifluoroethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2-trifluoroethanethiol?
The IUPAC name of 1,2,2-trifluoroethanethiol (CID 19438382) is 1,2,2-trifluoroethanethiol.
What is the SMILES notation for 1,2,2-trifluoroethanethiol?
The canonical SMILES for 1,2,2-trifluoroethanethiol is FC(F)C(F)S.
What is the InChIKey of 1,2,2-trifluoroethanethiol?
The InChIKey is LOIOGJZURNOUDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3F3S/c3-1(4)2(5)6/h1-2,6H.
What are the key properties of 1,2,2-trifluoroethanethiol?
1,2,2-trifluoroethanethiol has a molecular weight of 116.11 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2-trifluoroethanethiol is sourced from PubChem (CID 19438382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).