About azane;2-ethyl-1,1-dimethylhydrazine
azane;2-ethyl-1,1-dimethylhydrazine (PubChem CID 19438602) has the molecular formula C4H15N3
and a molecular weight of 105.18 g/mol. Its IUPAC name is azane;2-ethyl-1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | azane;2-ethyl-1,1-dimethylhydrazine |
| PubChem CID | 19438602 |
| Molecular Formula | C4H15N3 |
| Molecular Weight | 105.18 g/mol |
| Exact Mass | 105.13 |
| IUPAC Name | azane;2-ethyl-1,1-dimethylhydrazine |
| SMILES | CCNN(C)C.N |
| InChI | InChI=1S/C4H12N2.H3N/c1-4-5-6(2)3;/h5H,4H2,1-3H3;1H3 |
| InChIKey | LKPNEVKZSTYGKZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 50.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.18 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;2-ethyl-1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-ethyl-1,1-dimethylhydrazine?
The IUPAC name of azane;2-ethyl-1,1-dimethylhydrazine (CID 19438602) is azane;2-ethyl-1,1-dimethylhydrazine.
What is the SMILES notation for azane;2-ethyl-1,1-dimethylhydrazine?
The canonical SMILES for azane;2-ethyl-1,1-dimethylhydrazine is CCNN(C)C.N.
What is the InChIKey of azane;2-ethyl-1,1-dimethylhydrazine?
The InChIKey is LKPNEVKZSTYGKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N2.H3N/c1-4-5-6(2)3;/h5H,4H2,1-3H3;1H3.
What are the key properties of azane;2-ethyl-1,1-dimethylhydrazine?
azane;2-ethyl-1,1-dimethylhydrazine has a molecular weight of 105.18 g/mol, XLogP of 0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-ethyl-1,1-dimethylhydrazine is sourced from PubChem (CID 19438602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).