About 1-[3-[[3-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-hydroxypropyl]amino]propyl]pyrrole-2,5-dione
1-[3-[[3-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-hydroxypropyl]amino]propyl]pyrrole-2,5-dione (PubChem CID 19438623) has the molecular formula C17H24N4O5
and a molecular weight of 364.40 g/mol. Its IUPAC name is 1-[3-[[3-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-hydroxypropyl]amino]propyl]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-[3-[[3-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-hydroxypropyl]amino]propyl]pyrrole-2,5-dione |
| PubChem CID | 19438623 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-[3-[[3-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-hydroxypropyl]amino]propyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCNCC(O)CNCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H24N4O5/c22-13(11-18-7-1-9-20-14(23)3-4-15(20)24)12-19-8-2-10-21-16(25)5-6-17(21)26/h3-6,13,18-19,22H,1-2,7-12H2 |
| InChIKey | COVIBJVVTWSRPE-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[[3-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-hydroxypropyl]amino]propyl]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[[3-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-hydroxypropyl]amino]propyl]pyrrole-2,5-dione?
The IUPAC name of 1-[3-[[3-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-hydroxypropyl]amino]propyl]pyrrole-2,5-dione (CID 19438623) is 1-[3-[[3-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-hydroxypropyl]amino]propyl]pyrrole-2,5-dione.
What is the SMILES notation for 1-[3-[[3-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-hydroxypropyl]amino]propyl]pyrrole-2,5-dione?
The canonical SMILES for 1-[3-[[3-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-hydroxypropyl]amino]propyl]pyrrole-2,5-dione is O=C1C=CC(=O)N1CCCNCC(O)CNCCCN1C(=O)C=CC1=O.
What is the InChIKey of 1-[3-[[3-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-hydroxypropyl]amino]propyl]pyrrole-2,5-dione?
The InChIKey is COVIBJVVTWSRPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O5/c22-13(11-18-7-1-9-20-14(23)3-4-15(20)24)12-19-8-2-10-21-16(25)5-6-17(21)26/h3-6,13,18-19,22H,1-2,7-12H2.
What are the key properties of 1-[3-[[3-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-hydroxypropyl]amino]propyl]pyrrole-2,5-dione?
1-[3-[[3-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-hydroxypropyl]amino]propyl]pyrrole-2,5-dione has a molecular weight of 364.40 g/mol, XLogP of -1.84, 12 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[[3-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-hydroxypropyl]amino]propyl]pyrrole-2,5-dione is sourced from PubChem (CID 19438623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).